CAS 1023524-41-5 is the registry number for 3,5-dimethyl-2-(((4-(trifluoromethoxy)phenyl)amino)carbonylamino)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg.
3,5-dimethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]benzoic acid (CAS 1023524-41-5) is a chemical compound with the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. IUPAC name: 3,5-dimethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]benzoic acid. InChIKey: TXWVZFGUGOCCSU-UHFFFAOYSA-N.
| Molecular formula | C17H15F3N2O4 |
|---|---|
| Molecular weight | 368.31 g/mol |
| IUPAC name | 3,5-dimethyl-2-[[4-(trifluoromethoxy)phenyl]carbamoylamino]benzoic acid |
| InChIKey | TXWVZFGUGOCCSU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(=O)O)NC(=O)NC2=CC=C(C=C2)OC(F)(F)F)C |
Computed by PubChem (NCBI)