Products 2745108-35-2
CAS 2745108-35-2 is the registry number for TOPK-p38/JNK-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(5-acetyl-4-hydroxy-2-methoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea (CAS 2745108-35-2) is a chemical compound with the molecular formula C17H15F3N2O4 and a molecular weight of 368.31 g/mol. IUPAC name: 1-(5-acetyl-4-hydroxy-2-methoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea. InChIKey: GHJDMUOTXYVBEB-UHFFFAOYSA-N.
| Molecular formula | C17H15F3N2O4 |
|---|---|
| Molecular weight | 368.31 g/mol |
| IUPAC name | 1-(5-acetyl-4-hydroxy-2-methoxyphenyl)-3-[3-(trifluoromethyl)phenyl]urea |
| InChIKey | GHJDMUOTXYVBEB-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1O)OC)NC(=O)NC2=CC=CC(=C2)C(F)(F)F |
Computed by PubChem (NCBI)