CAS 1023533-10-9 is the registry number for 3-(4-ethoxyphenyl)-5-(1-methylindol-3-yl)-1H,4H,5H-1,2-diazin-6-one. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg, 2000mg.
3-(4-ethoxyphenyl)-5-(1-methylindol-3-yl)-4,5-dihydro-1H-pyridazin-6-one (CAS 1023533-10-9) is a chemical compound with the molecular formula C21H21N3O2 and a molecular weight of 347.4 g/mol. IUPAC name: 3-(4-ethoxyphenyl)-5-(1-methylindol-3-yl)-4,5-dihydro-1H-pyridazin-6-one. InChIKey: JMTAMUWSSSBSOH-UHFFFAOYSA-N.
| Molecular formula | C21H21N3O2 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 3-(4-ethoxyphenyl)-5-(1-methylindol-3-yl)-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | JMTAMUWSSSBSOH-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2=NNC(=O)C(C2)C3=CN(C4=CC=CC=C43)C |
Computed by PubChem (NCBI)