CAS 370582-00-6 is the registry number for H-Phe-Gly-bNA. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
(2S)-2-amino-N-[2-(naphthalen-2-ylamino)-2-oxoethyl]-3-phenylpropanamide (CAS 370582-00-6) is a chemical compound with the molecular formula C21H21N3O2 and a molecular weight of 347.4 g/mol. IUPAC name: (2S)-2-amino-N-[2-(naphthalen-2-ylamino)-2-oxoethyl]-3-phenylpropanamide. InChIKey: IAUQNVNSCONVRO-IBGZPJMESA-N.
| Molecular formula | C21H21N3O2 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (2S)-2-amino-N-[2-(naphthalen-2-ylamino)-2-oxoethyl]-3-phenylpropanamide |
| InChIKey | IAUQNVNSCONVRO-IBGZPJMESA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H](C(=O)NCC(=O)NC2=CC3=CC=CC=C3C=C2)N |
Computed by PubChem (NCBI)