CAS 1023540-36-4 is the registry number for 1-(3-acetylphenyl)-2,6-dimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-(3-acetylphenyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one (CAS 1023540-36-4) is a chemical compound with the molecular formula C18H19NO2 and a molecular weight of 281.3 g/mol. IUPAC name: 1-(3-acetylphenyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one. InChIKey: BXICFSNMDASMRR-UHFFFAOYSA-N.
| Molecular formula | C18H19NO2 |
|---|---|
| Molecular weight | 281.3 g/mol |
| IUPAC name | 1-(3-acetylphenyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one |
| InChIKey | BXICFSNMDASMRR-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C=C(N2C3=CC=CC(=C3)C(=O)C)C)C(=O)C1 |
Computed by PubChem (NCBI)