Products 1023548-64-2
CAS 1023548-64-2 is the registry number for N-(2-methyl-3-nitrophenyl)(phenylcyclopentyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(2-methyl-3-nitrophenyl)-1-phenylcyclopentane-1-carboxamide (CAS 1023548-64-2) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: N-(2-methyl-3-nitrophenyl)-1-phenylcyclopentane-1-carboxamide. InChIKey: JGBHZEZKAUNLGK-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | N-(2-methyl-3-nitrophenyl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | JGBHZEZKAUNLGK-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])NC(=O)C2(CCCC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)