Products 1023556-71-9
CAS 1023556-71-9 is the registry number for 4-((((2-indol-3-ylethyl)amino)thioxomethyl)amino)benzenecarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-cyanophenyl)-3-[2-(1H-indol-3-yl)ethyl]thiourea (CAS 1023556-71-9) is a chemical compound with the molecular formula C18H16N4S and a molecular weight of 320.4 g/mol. IUPAC name: 1-(4-cyanophenyl)-3-[2-(1H-indol-3-yl)ethyl]thiourea. InChIKey: CWBQHPSPUCWUCD-UHFFFAOYSA-N.
| Molecular formula | C18H16N4S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 1-(4-cyanophenyl)-3-[2-(1H-indol-3-yl)ethyl]thiourea |
| InChIKey | CWBQHPSPUCWUCD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=S)NC3=CC=C(C=C3)C#N |
Computed by PubChem (NCBI)