Products 682793-07-3
CAS 682793-07-3 appears in our catalog under these names: AP-C2/ 100%, AP-C2. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1 mg.
N-[2-(1H-indol-3-yl)ethyl]-4-thiophen-2-ylpyrimidin-2-amine (CAS 682793-07-3) is a chemical compound with the molecular formula C18H16N4S and a molecular weight of 320.4 g/mol. IUPAC name: N-[2-(1H-indol-3-yl)ethyl]-4-thiophen-2-ylpyrimidin-2-amine. InChIKey: ZIHUVIWSMDMZOU-UHFFFAOYSA-N.
| Molecular formula | C18H16N4S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | N-[2-(1H-indol-3-yl)ethyl]-4-thiophen-2-ylpyrimidin-2-amine |
| InChIKey | ZIHUVIWSMDMZOU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC3=NC=CC(=N3)C4=CC=CS4 |
Computed by PubChem (NCBI)