Products 1023556-73-1
CAS 1023556-73-1 is the registry number for N-(6-nitrobenzothiazol-2-yl)(phenylcyclopentyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(6-nitro-1,3-benzothiazol-2-yl)-1-phenylcyclopentane-1-carboxamide (CAS 1023556-73-1) is a chemical compound with the molecular formula C19H17N3O3S and a molecular weight of 367.4 g/mol. IUPAC name: N-(6-nitro-1,3-benzothiazol-2-yl)-1-phenylcyclopentane-1-carboxamide. InChIKey: LFDPRPNLYNHVKL-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O3S |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | N-(6-nitro-1,3-benzothiazol-2-yl)-1-phenylcyclopentane-1-carboxamide |
| InChIKey | LFDPRPNLYNHVKL-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=CC=C2)C(=O)NC3=NC4=C(S3)C=C(C=C4)[N+](=O)[O-] |
Computed by PubChem (NCBI)