CAS 215917-77-4 is the registry number for N-(2-(3-Phenylureido)phenyl)benzenesulfonamide 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-[2-(benzenesulfonamido)phenyl]-3-phenylurea (CAS 215917-77-4) is a chemical compound with the molecular formula C19H17N3O3S and a molecular weight of 367.4 g/mol. IUPAC name: 1-[2-(benzenesulfonamido)phenyl]-3-phenylurea. InChIKey: BGLZECVIKIGPIF-UHFFFAOYSA-N.
| Molecular formula | C19H17N3O3S |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 1-[2-(benzenesulfonamido)phenyl]-3-phenylurea |
| InChIKey | BGLZECVIKIGPIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC(=O)NC2=CC=CC=C2NS(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)