Products 1023590-22-8
CAS 1023590-22-8 is the registry number for 5,5-dimethyl-3-((4-(trifluoromethoxy)phenyl)amino)cyclohex-2-en-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-one (CAS 1023590-22-8) is a chemical compound with the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. IUPAC name: 5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-one. InChIKey: RGMNYOSFPWUYDC-UHFFFAOYSA-N.
| Molecular formula | C15H16F3NO2 |
|---|---|
| Molecular weight | 299.29 g/mol |
| IUPAC name | 5,5-dimethyl-3-[4-(trifluoromethoxy)anilino]cyclohex-2-en-1-one |
| InChIKey | RGMNYOSFPWUYDC-UHFFFAOYSA-N |
| SMILES | CC1(CC(=CC(=O)C1)NC2=CC=C(C=C2)OC(F)(F)F)C |
Computed by PubChem (NCBI)