CAS 1198285-26-5 is the registry number for 2,2,2-Trifluoro-1-(4-(4-methylbenzoyl)piperidin-1-yl)ethanone, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
2,2,2-trifluoro-1-[4-(4-methylbenzoyl)piperidin-1-yl]ethanone (CAS 1198285-26-5) is a chemical compound with the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. IUPAC name: 2,2,2-trifluoro-1-[4-(4-methylbenzoyl)piperidin-1-yl]ethanone. InChIKey: ATYGIIRPFYKOHU-UHFFFAOYSA-N.
| Molecular formula | C15H16F3NO2 |
|---|---|
| Molecular weight | 299.29 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-[4-(4-methylbenzoyl)piperidin-1-yl]ethanone |
| InChIKey | ATYGIIRPFYKOHU-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)C2CCN(CC2)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)