CAS 1023717-11-4 is the registry number for 3'-Fluoro-4'-methoxy-beta-methyl-beta-nitrostyrene. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg, 2000mg.
2-fluoro-1-methoxy-4-[(E)-2-nitroprop-1-enyl]benzene (CAS 1023717-11-4) is a chemical compound with the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. IUPAC name: 2-fluoro-1-methoxy-4-[(E)-2-nitroprop-1-enyl]benzene. InChIKey: SMYLIBSWIHOBGJ-FNORWQNLSA-N.
| Molecular formula | C10H10FNO3 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | 2-fluoro-1-methoxy-4-[(E)-2-nitroprop-1-enyl]benzene |
| InChIKey | SMYLIBSWIHOBGJ-FNORWQNLSA-N |
| SMILES | C/C(=C\C1=CC(=C(C=C1)OC)F)/[N+](=O)[O-] |
Computed by PubChem (NCBI)