CAS 84023-28-9 is the registry number for 1-(3-Fluoro-4-methoxyphenyl)-2-nitropropene. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
2-fluoro-1-methoxy-4-[(Z)-2-nitroprop-1-enyl]benzene (CAS 84023-28-9) is a chemical compound with the molecular formula C10H10FNO3 and a molecular weight of 211.19 g/mol. IUPAC name: 2-fluoro-1-methoxy-4-[(Z)-2-nitroprop-1-enyl]benzene. InChIKey: SMYLIBSWIHOBGJ-ALCCZGGFSA-N.
| Molecular formula | C10H10FNO3 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | 2-fluoro-1-methoxy-4-[(Z)-2-nitroprop-1-enyl]benzene |
| InChIKey | SMYLIBSWIHOBGJ-ALCCZGGFSA-N |
| SMILES | C/C(=C/C1=CC(=C(C=C1)OC)F)/[N+](=O)[O-] |
Computed by PubChem (NCBI)