Products 1023798-42-6
CAS 1023798-42-6 is the registry number for 2-(4-(5-chloro-2-methylphenyl)piperazinyl)-N,N-diphenylethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N,N-diphenylacetamide (CAS 1023798-42-6) is a chemical compound with the molecular formula C25H26ClN3O and a molecular weight of 419.9 g/mol. IUPAC name: 2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N,N-diphenylacetamide. InChIKey: RMZOPPJWJONNRP-UHFFFAOYSA-N.
| Molecular formula | C25H26ClN3O |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-N,N-diphenylacetamide |
| InChIKey | RMZOPPJWJONNRP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)N2CCN(CC2)CC(=O)N(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)