CAS 1380392-05-1 appears in our catalog under these names: JMS-17-2/ 98.7% (existing batch purity), JMS–17–2, JMS-17-2, 5-(3-(4-(4-Chlorophenyl)piperidin-1-yl)propyl)pyrrolo[1,2-a]quinoxalin-4(5H)-one, 97%, 97%, JMS-17-2, 99.59%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
5-[3-[4-(4-chlorophenyl)piperidin-1-yl]propyl]pyrrolo[1,2-a]quinoxalin-4-one (CAS 1380392-05-1) is a chemical compound with the molecular formula C25H26ClN3O and a molecular weight of 419.9 g/mol. IUPAC name: 5-[3-[4-(4-chlorophenyl)piperidin-1-yl]propyl]pyrrolo[1,2-a]quinoxalin-4-one. InChIKey: WOSMCMULWWHMIV-UHFFFAOYSA-N.
| Molecular formula | C25H26ClN3O |
|---|---|
| Molecular weight | 419.9 g/mol |
| IUPAC name | 5-[3-[4-(4-chlorophenyl)piperidin-1-yl]propyl]pyrrolo[1,2-a]quinoxalin-4-one |
| InChIKey | WOSMCMULWWHMIV-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1C2=CC=C(C=C2)Cl)CCCN3C4=CC=CC=C4N5C=CC=C5C3=O |
Computed by PubChem (NCBI)