Products 1023814-45-0
CAS 1023814-45-0 is the registry number for OUL245. Offered by: MedChemExpress. Available pack sizes: Get quote.
[1,2,4]triazolo[3,4-b][1,3]benzothiazol-6-ol (CAS 1023814-45-0) is a chemical compound with the molecular formula C8H5N3OS and a molecular weight of 191.21 g/mol. IUPAC name: [1,2,4]triazolo[3,4-b][1,3]benzothiazol-6-ol. InChIKey: IWIXTZQBCXYDRG-UHFFFAOYSA-N.
| Molecular formula | C8H5N3OS |
|---|---|
| Molecular weight | 191.21 g/mol |
| IUPAC name | [1,2,4]triazolo[3,4-b][1,3]benzothiazol-6-ol |
| InChIKey | IWIXTZQBCXYDRG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)SC3=NN=CN23 |
Computed by PubChem (NCBI)