CAS 1250594-09-2 is the registry number for 2-(Pyrazin-2-yl)-1,3-thiazole-5-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-pyrazin-2-yl-1,3-thiazole-5-carbaldehyde (CAS 1250594-09-2) is a chemical compound with the molecular formula C8H5N3OS and a molecular weight of 191.21 g/mol. IUPAC name: 2-pyrazin-2-yl-1,3-thiazole-5-carbaldehyde. InChIKey: OTFGFECCZFFMNA-UHFFFAOYSA-N.
| Molecular formula | C8H5N3OS |
|---|---|
| Molecular weight | 191.21 g/mol |
| IUPAC name | 2-pyrazin-2-yl-1,3-thiazole-5-carbaldehyde |
| InChIKey | OTFGFECCZFFMNA-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NC=C(S2)C=O |
Computed by PubChem (NCBI)