Products 1023819-24-0
CAS 1023819-24-0 is the registry number for ((2,5-dichlorophenyl)amino)-N-(2-indol-3-ylethyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-(2,5-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea (CAS 1023819-24-0) is a chemical compound with the molecular formula C17H15Cl2N3O and a molecular weight of 348.2 g/mol. IUPAC name: 1-(2,5-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea. InChIKey: QFFIPIVBUBZQHU-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2N3O |
|---|---|
| Molecular weight | 348.2 g/mol |
| IUPAC name | 1-(2,5-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea |
| InChIKey | QFFIPIVBUBZQHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)NC3=C(C=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)