CAS 32539-39-2 is the registry number for ((3,4-dichlorophenyl)amino)-N-(2-indol-3-ylethyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
1-(3,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea (CAS 32539-39-2) is a chemical compound with the molecular formula C17H15Cl2N3O and a molecular weight of 348.2 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea. InChIKey: JAWNRLZTUAFYAS-UHFFFAOYSA-N.
| Molecular formula | C17H15Cl2N3O |
|---|---|
| Molecular weight | 348.2 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-3-[2-(1H-indol-3-yl)ethyl]urea |
| InChIKey | JAWNRLZTUAFYAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCNC(=O)NC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)