Products 1023850-58-9
CAS 1023850-58-9 is the registry number for 5-methyl-2-(2-oxo-2-(4-phenylphenyl)ethyl)cyclohexane-1,3-dione. Offered by: Biosynth. Available pack sizes: 1000mg, 500mg.
5-methyl-2-[2-oxo-2-(4-phenylphenyl)ethyl]cyclohexane-1,3-dione (CAS 1023850-58-9) is a chemical compound with the molecular formula C21H20O3 and a molecular weight of 320.4 g/mol. IUPAC name: 5-methyl-2-[2-oxo-2-(4-phenylphenyl)ethyl]cyclohexane-1,3-dione. InChIKey: ALKUTOKYIMQMRI-UHFFFAOYSA-N.
| Molecular formula | C21H20O3 |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 5-methyl-2-[2-oxo-2-(4-phenylphenyl)ethyl]cyclohexane-1,3-dione |
| InChIKey | ALKUTOKYIMQMRI-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C(C(=O)C1)CC(=O)C2=CC=C(C=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)