Products 681460-17-3

CAS 681460-17-3 is the registry number for 3-(1-hydroxy-4,4-diphenylcyclohexyl)propiolic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

3-(1-hydroxy-4,4-diphenylcyclohexyl)prop-2-ynoic acid (CAS 681460-17-3) is a chemical compound with the molecular formula C21H20O3 and a molecular weight of 320.4 g/mol. IUPAC name: 3-(1-hydroxy-4,4-diphenylcyclohexyl)prop-2-ynoic acid. InChIKey: JMSXKMQCQWTJGU-UHFFFAOYSA-N.

Identity
Molecular formulaC21H20O3
Molecular weight320.4 g/mol
IUPAC name3-(1-hydroxy-4,4-diphenylcyclohexyl)prop-2-ynoic acid
InChIKeyJMSXKMQCQWTJGU-UHFFFAOYSA-N
SMILESC1CC(CCC1(C#CC(=O)O)O)(C2=CC=CC=C2)C3=CC=CC=C3

Computed by PubChem (NCBI)