CAS 102394-28-5 appears in our catalog under these names: 4-Hydroxy Metsulfuron-Methyl, G 7460, >95% (HPLC), 4-Hydroxymetsulfuron-methyl, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, HPC Standards. Available pack sizes: on request, 100mg, 10mg, 50mg, 1x1ml.
Methyl 4-hydroxy-2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate (CAS 102394-28-5) is a chemical compound with the molecular formula C14H15N5O7S and a molecular weight of 397.37 g/mol. IUPAC name: methyl 4-hydroxy-2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate. InChIKey: YDQFJWNPRLHOFT-UHFFFAOYSA-N.
| Molecular formula | C14H15N5O7S |
|---|---|
| Molecular weight | 397.37 g/mol |
| IUPAC name | methyl 4-hydroxy-2-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate |
| InChIKey | YDQFJWNPRLHOFT-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=N1)OC)NC(=O)NS(=O)(=O)C2=C(C=CC(=C2)O)C(=O)OC |
Computed by PubChem (NCBI)