CAS 74223-63-5 is the registry number for Desmethyl Methoxy Metsulfuron-methyl. Offered by: TRC. Available pack sizes: 500mg.
Methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate (CAS 74223-63-5) is a chemical compound with the molecular formula C14H15N5O7S and a molecular weight of 397.37 g/mol. IUPAC name: methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate. InChIKey: PELUGJARGQUTRZ-UHFFFAOYSA-N.
| Molecular formula | C14H15N5O7S |
|---|---|
| Molecular weight | 397.37 g/mol |
| IUPAC name | methyl 2-[(4,6-dimethoxy-1,3,5-triazin-2-yl)carbamoylsulfamoyl]benzoate |
| InChIKey | PELUGJARGQUTRZ-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC(=N1)NC(=O)NS(=O)(=O)C2=CC=CC=C2C(=O)OC)OC |
Computed by PubChem (NCBI)