Products 1024040-00-3

CAS 1024040-00-3 is the registry number for ethyl 2-(4-((4-phenoxyphenyl)amino)-3,5-thiazolyl)acetate. Offered by: Biosynth. Available pack sizes: 2g, 1g.

Structural formula: {0} (CAS {1})

Ethyl 2-[2-(4-phenoxyanilino)-1,3-thiazol-4-yl]acetate (CAS 1024040-00-3) is a chemical compound with the molecular formula C19H18N2O3S and a molecular weight of 354.4 g/mol. IUPAC name: ethyl 2-[2-(4-phenoxyanilino)-1,3-thiazol-4-yl]acetate. InChIKey: HQOSDNFQFKDFCO-UHFFFAOYSA-N.

Identity
Molecular formulaC19H18N2O3S
Molecular weight354.4 g/mol
IUPAC nameethyl 2-[2-(4-phenoxyanilino)-1,3-thiazol-4-yl]acetate
InChIKeyHQOSDNFQFKDFCO-UHFFFAOYSA-N
SMILESCCOC(=O)CC1=CSC(=N1)NC2=CC=C(C=C2)OC3=CC=CC=C3

Computed by PubChem (NCBI)