CAS 1024081-73-9 is the registry number for 2,3-dimethoxy-11-phenylindeno(3,2-b)quinolin-10-one. Offered by: Biosynth. Available pack sizes: 250mg.
7,8-dimethoxy-10-phenylindeno[1,2-b]quinolin-11-one (CAS 1024081-73-9) is a chemical compound with the molecular formula C24H17NO3 and a molecular weight of 367.4 g/mol. IUPAC name: 7,8-dimethoxy-10-phenylindeno[1,2-b]quinolin-11-one. InChIKey: UBXKWZDRXAEOTK-UHFFFAOYSA-N.
| Molecular formula | C24H17NO3 |
|---|---|
| Molecular weight | 367.4 g/mol |
| IUPAC name | 7,8-dimethoxy-10-phenylindeno[1,2-b]quinolin-11-one |
| InChIKey | UBXKWZDRXAEOTK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=C3C(=N2)C4=CC=CC=C4C3=O)C5=CC=CC=C5)OC |
Computed by PubChem (NCBI)