CAS 1024119-76-3 is the registry number for 2-(3,4-dimethoxyphenyl)-3-((3-nitrophenyl)amino)inden-1-one. Offered by: Biosynth. Available pack sizes: 250mg.
2-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)inden-1-one (CAS 1024119-76-3) is a chemical compound with the molecular formula C23H18N2O5 and a molecular weight of 402.4 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)inden-1-one. InChIKey: UKELQCXXUCDGII-UHFFFAOYSA-N.
| Molecular formula | C23H18N2O5 |
|---|---|
| Molecular weight | 402.4 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)inden-1-one |
| InChIKey | UKELQCXXUCDGII-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=C(C3=CC=CC=C3C2=O)NC4=CC(=CC=C4)[N+](=O)[O-])OC |
Computed by PubChem (NCBI)