Products 1024154-10-6
CAS 1024154-10-6 is the registry number for 1-methyl-4-(3-phenoxyphenyl)-1,2,3-triazole-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
3-methyl-5-(3-phenoxyphenyl)triazole-4-carbonitrile (CAS 1024154-10-6) is a chemical compound with the molecular formula C16H12N4O and a molecular weight of 276.29 g/mol. IUPAC name: 3-methyl-5-(3-phenoxyphenyl)triazole-4-carbonitrile. InChIKey: WWMBIWRCWCFBGH-UHFFFAOYSA-N.
| Molecular formula | C16H12N4O |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 3-methyl-5-(3-phenoxyphenyl)triazole-4-carbonitrile |
| InChIKey | WWMBIWRCWCFBGH-UHFFFAOYSA-N |
| SMILES | CN1C(=C(N=N1)C2=CC(=CC=C2)OC3=CC=CC=C3)C#N |
Computed by PubChem (NCBI)