CAS 1244902-84-8 is the registry number for 2-(2-(2-Furanyl)-5-pyrimidinyl)-7-methyl-1H-benzimidazole. Offered by: TRC. Available pack sizes: 100mg.
2-[2-(furan-2-yl)pyrimidin-5-yl]-4-methyl-1H-benzimidazole (CAS 1244902-84-8) is a chemical compound with the molecular formula C16H12N4O and a molecular weight of 276.29 g/mol. IUPAC name: 2-[2-(furan-2-yl)pyrimidin-5-yl]-4-methyl-1H-benzimidazole. InChIKey: MZVRQFKPCGQBKK-UHFFFAOYSA-N.
| Molecular formula | C16H12N4O |
|---|---|
| Molecular weight | 276.29 g/mol |
| IUPAC name | 2-[2-(furan-2-yl)pyrimidin-5-yl]-4-methyl-1H-benzimidazole |
| InChIKey | MZVRQFKPCGQBKK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)NC(=N2)C3=CN=C(N=C3)C4=CC=CO4 |
Computed by PubChem (NCBI)