CAS 1024208-85-2 appears in our catalog under these names: 2,2,4,6,8-Pentamethyl-1,2-dihydroquinoline, 95%, 2,2,4,6,8-Pentamethyl-1,2-dihydroquinoline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2,2,4,6,8-pentamethyl-1H-quinoline (CAS 1024208-85-2) is a chemical compound with the molecular formula C14H19N and a molecular weight of 201.31 g/mol. IUPAC name: 2,2,4,6,8-pentamethyl-1H-quinoline. InChIKey: SVHOHMXWCUSMAK-UHFFFAOYSA-N.
| Molecular formula | C14H19N |
|---|---|
| Molecular weight | 201.31 g/mol |
| IUPAC name | 2,2,4,6,8-pentamethyl-1H-quinoline |
| InChIKey | SVHOHMXWCUSMAK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(N2)(C)C)C)C |
Computed by PubChem (NCBI)