CAS 42924-00-5 appears in our catalog under these names: 6-Ethyl-2,2,4-trimethyl-1,2-dihydroquinoline, 95%, Quinoline, 6-ethyl-1,2-dihydro-2,2,4-trimethyl-, 98%, 98%, 6-Ethyl-2,2,4-trimethyl-1,2-dihydroquinoline, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 100mg.
6-ethyl-2,2,4-trimethyl-1H-quinoline (CAS 42924-00-5) is a chemical compound with the molecular formula C14H19N and a molecular weight of 201.31 g/mol. IUPAC name: 6-ethyl-2,2,4-trimethyl-1H-quinoline. InChIKey: YZPJUVSKXVLDHD-UHFFFAOYSA-N.
| Molecular formula | C14H19N |
|---|---|
| Molecular weight | 201.31 g/mol |
| IUPAC name | 6-ethyl-2,2,4-trimethyl-1H-quinoline |
| InChIKey | YZPJUVSKXVLDHD-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)NC(C=C2C)(C)C |
Computed by PubChem (NCBI)