CAS 1024376-38-2 is the registry number for (2-Chloro(3-pyridyl))-N-(4-(1,2,4-triazolyl)phenyl)formamide. Offered by: Biosynth. Available pack sizes: 5000mg.
2-chloro-N-[4-(1,2,4-triazol-1-yl)phenyl]pyridine-3-carboxamide (CAS 1024376-38-2) is a chemical compound with the molecular formula C14H10ClN5O and a molecular weight of 299.71 g/mol. IUPAC name: 2-chloro-N-[4-(1,2,4-triazol-1-yl)phenyl]pyridine-3-carboxamide. InChIKey: INOQIPPPAGXZGI-UHFFFAOYSA-N.
| Molecular formula | C14H10ClN5O |
|---|---|
| Molecular weight | 299.71 g/mol |
| IUPAC name | 2-chloro-N-[4-(1,2,4-triazol-1-yl)phenyl]pyridine-3-carboxamide |
| InChIKey | INOQIPPPAGXZGI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)Cl)C(=O)NC2=CC=C(C=C2)N3C=NC=N3 |
Computed by PubChem (NCBI)