CAS 1024403-17-5 is the registry number for 7-methyl-3-(4-phenylphenyl)-1,4,6,7,8-pentahydrocinnolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
7-methyl-3-(4-phenylphenyl)-4,6,7,8-tetrahydro-1H-cinnolin-5-one (CAS 1024403-17-5) is a chemical compound with the molecular formula C21H20N2O and a molecular weight of 316.4 g/mol. IUPAC name: 7-methyl-3-(4-phenylphenyl)-4,6,7,8-tetrahydro-1H-cinnolin-5-one. InChIKey: TZTNCSDQKUQROP-UHFFFAOYSA-N.
| Molecular formula | C21H20N2O |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 7-methyl-3-(4-phenylphenyl)-4,6,7,8-tetrahydro-1H-cinnolin-5-one |
| InChIKey | TZTNCSDQKUQROP-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(CC(=NN2)C3=CC=C(C=C3)C4=CC=CC=C4)C(=O)C1 |
Computed by PubChem (NCBI)