CAS 76145-76-1 is the registry number for Tomoxiprole. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-methoxyphenyl)-3-propan-2-ylbenzo[e]benzimidazole (CAS 76145-76-1) is a chemical compound with the molecular formula C21H20N2O and a molecular weight of 316.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-3-propan-2-ylbenzo[e]benzimidazole. InChIKey: XVDXNSRMHBAVAX-UHFFFAOYSA-N.
| Molecular formula | C21H20N2O |
|---|---|
| Molecular weight | 316.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-3-propan-2-ylbenzo[e]benzimidazole |
| InChIKey | XVDXNSRMHBAVAX-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=C(C3=CC=CC=C3C=C2)N=C1C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)