Products 1024415-31-3
CAS 1024415-31-3 is the registry number for N-(4-(2,6,6-trimethyl-4-oxo-5,6,7-trihydroindolyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-[4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)phenyl]acetamide (CAS 1024415-31-3) is a chemical compound with the molecular formula C19H22N2O2 and a molecular weight of 310.4 g/mol. IUPAC name: N-[4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)phenyl]acetamide. InChIKey: DENRBHTVXUVMMI-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | N-[4-(2,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)phenyl]acetamide |
| InChIKey | DENRBHTVXUVMMI-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC=C(C=C3)NC(=O)C)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)