Products 1024439-41-5
CAS 1024439-41-5 is the registry number for 1-(2-(4-ethylphenoxy)acetyl)-4-((4-methylphenyl)sulfonyl)semicarbazide. Offered by: Biosynth. Available pack sizes: 250mg.
1-[[2-(4-ethylphenoxy)acetyl]amino]-3-(4-methylphenyl)sulfonylurea (CAS 1024439-41-5) is a chemical compound with the molecular formula C18H21N3O5S and a molecular weight of 391.4 g/mol. IUPAC name: 1-[[2-(4-ethylphenoxy)acetyl]amino]-3-(4-methylphenyl)sulfonylurea. InChIKey: QCHOMOVVMSQYFM-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O5S |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | 1-[[2-(4-ethylphenoxy)acetyl]amino]-3-(4-methylphenyl)sulfonylurea |
| InChIKey | QCHOMOVVMSQYFM-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)OCC(=O)NNC(=O)NS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)