Products 695160-12-4
CAS 695160-12-4 appears in our catalog under these names: MBX2546, MBX2546, 99.9%. Offered by: Biosynth, MedChemExpress. Available pack sizes: 100mg, 50mg, 1 mg, 5 mg.
N-(3,5-dimethylphenyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide (CAS 695160-12-4) is a chemical compound with the molecular formula C18H21N3O5S and a molecular weight of 391.4 g/mol. IUPAC name: N-(3,5-dimethylphenyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide. InChIKey: XPPCEUZUDQSVQO-UHFFFAOYSA-N.
| Molecular formula | C18H21N3O5S |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | N-(3,5-dimethylphenyl)-2-(2-methyl-N-methylsulfonyl-5-nitroanilino)acetamide |
| InChIKey | XPPCEUZUDQSVQO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])N(CC(=O)NC2=CC(=CC(=C2)C)C)S(=O)(=O)C |
Computed by PubChem (NCBI)