CAS 1024445-52-0 is the registry number for 5-(4-chlorophenyl)-3-methoxy-4-phenyl-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 250mg.
3-(4-chlorophenyl)-5-methoxy-4-phenyl-1,2,4-triazole (CAS 1024445-52-0) is a chemical compound with the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. IUPAC name: 3-(4-chlorophenyl)-5-methoxy-4-phenyl-1,2,4-triazole. InChIKey: LOGUEJGCNZQEKK-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O |
|---|---|
| Molecular weight | 285.73 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-5-methoxy-4-phenyl-1,2,4-triazole |
| InChIKey | LOGUEJGCNZQEKK-UHFFFAOYSA-N |
| SMILES | COC1=NN=C(N1C2=CC=CC=C2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)