CAS 7722-15-8 appears in our catalog under these names: N-Demethyl Chlordiazepoxide, >95% (HPLC), N-Demethyl Chlordiazepoxide (1.0 mg/mL in 20% DMSO in Acetonitrile). Offered by: TRC. Available pack sizes: 250mg, 25mg, 3x1ml.
7-chloro-4-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-imine (CAS 7722-15-8) is a chemical compound with the molecular formula C15H12ClN3O and a molecular weight of 285.73 g/mol. IUPAC name: 7-chloro-4-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-imine. InChIKey: IRKXPJJKXBMOMW-UHFFFAOYSA-N.
| Molecular formula | C15H12ClN3O |
|---|---|
| Molecular weight | 285.73 g/mol |
| IUPAC name | 7-chloro-4-hydroxy-5-phenyl-3H-1,4-benzodiazepin-2-imine |
| InChIKey | IRKXPJJKXBMOMW-UHFFFAOYSA-N |
| SMILES | C1C(=N)N=C2C=CC(=CC2=C(N1O)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)