CAS 1024450-09-6 is the registry number for 2,2-dimethyl-7-(5-(trifluoromethyl)(2-pyridyloxy))oxaindane. Offered by: Biosynth. Available pack sizes: 250mg.
2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-5-(trifluoromethyl)pyridine (CAS 1024450-09-6) is a chemical compound with the molecular formula C16H14F3NO2 and a molecular weight of 309.28 g/mol. IUPAC name: 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-5-(trifluoromethyl)pyridine. InChIKey: OYFAQWJTSYQJEB-UHFFFAOYSA-N.
| Molecular formula | C16H14F3NO2 |
|---|---|
| Molecular weight | 309.28 g/mol |
| IUPAC name | 2-[(2,2-dimethyl-3H-1-benzofuran-7-yl)oxy]-5-(trifluoromethyl)pyridine |
| InChIKey | OYFAQWJTSYQJEB-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C(=CC=C2)OC3=NC=C(C=C3)C(F)(F)F)C |
Computed by PubChem (NCBI)