Products 1024480-51-0
CAS 1024480-51-0 is the registry number for 1-(6-methoxy(3-pyridyl))-2,6-dimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 250mg.
1-(6-methoxy-3-pyridinyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one (CAS 1024480-51-0) is a chemical compound with the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. IUPAC name: 1-(6-methoxy-3-pyridinyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one. InChIKey: YWIJIPISLBSBFK-UHFFFAOYSA-N.
| Molecular formula | C16H18N2O2 |
|---|---|
| Molecular weight | 270.33 g/mol |
| IUPAC name | 1-(6-methoxy-3-pyridinyl)-2,6-dimethyl-6,7-dihydro-5H-indol-4-one |
| InChIKey | YWIJIPISLBSBFK-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(C=C(N2C3=CN=C(C=C3)OC)C)C(=O)C1 |
Computed by PubChem (NCBI)