CAS 1024490-13-8 is the registry number for 4-Isopropylbenzo(d)thiazol-2-amine, 97%. Offered by: AmBeed. Available pack sizes: 5g.
4-propan-2-yl-1,3-benzothiazol-2-amine (CAS 1024490-13-8) is a chemical compound with the molecular formula C10H12N2S and a molecular weight of 192.28 g/mol. IUPAC name: 4-propan-2-yl-1,3-benzothiazol-2-amine. InChIKey: GRUGSZVVRNGXOX-UHFFFAOYSA-N.
| Molecular formula | C10H12N2S |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | 4-propan-2-yl-1,3-benzothiazol-2-amine |
| InChIKey | GRUGSZVVRNGXOX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C2C(=CC=C1)SC(=N2)N |
Computed by PubChem (NCBI)