Products 730950-96-6
CAS 730950-96-6 appears in our catalog under these names: 4-Amino-3-ethyl-5-methylphenyl thiocyanate, 95%, ((4-Amino-3-ethyl-5-methylphenyl)sulfanyl)formonitrile, 95%, ((4-Amino-3-ethyl-5-methylphenyl)sulfanyl)formonitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
(4-amino-3-ethyl-5-methylphenyl) thiocyanate (CAS 730950-96-6) is a chemical compound with the molecular formula C10H12N2S and a molecular weight of 192.28 g/mol. IUPAC name: (4-amino-3-ethyl-5-methylphenyl) thiocyanate. InChIKey: ARNYTCIHTIYQHE-UHFFFAOYSA-N.
| Molecular formula | C10H12N2S |
|---|---|
| Molecular weight | 192.28 g/mol |
| IUPAC name | (4-amino-3-ethyl-5-methylphenyl) thiocyanate |
| InChIKey | ARNYTCIHTIYQHE-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC(=C1)SC#N)C)N |
Computed by PubChem (NCBI)