Products 1024613-61-3
CAS 1024613-61-3 appears in our catalog under these names: 2-Amino-2-(4-methoxy-3-methylphenyl)acetic acid, 98%, 2-Amino-2-(4-methoxy-3-methylphenyl)acetic acid, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
2-amino-2-(4-methoxy-3-methylphenyl)acetic acid (CAS 1024613-61-3) is a chemical compound with the molecular formula C10H13NO3 and a molecular weight of 195.21 g/mol. IUPAC name: 2-amino-2-(4-methoxy-3-methylphenyl)acetic acid. InChIKey: MKDABEIUZAXUSQ-UHFFFAOYSA-N.
| Molecular formula | C10H13NO3 |
|---|---|
| Molecular weight | 195.21 g/mol |
| IUPAC name | 2-amino-2-(4-methoxy-3-methylphenyl)acetic acid |
| InChIKey | MKDABEIUZAXUSQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C(C(=O)O)N)OC |
Computed by PubChem (NCBI)