Products 1024726-20-2
CAS 1024726-20-2 is the registry number for N-(4-(2-((tert-butyl)sulfonyl)-2-nitrilovinyl)phenyl)ethanamide. Offered by: Biosynth. Available pack sizes: 100mg.
N-[4-[(E)-2-tert-butylsulfonyl-2-cyanoethenyl]phenyl]acetamide (CAS 1024726-20-2) is a chemical compound with the molecular formula C15H18N2O3S and a molecular weight of 306.4 g/mol. IUPAC name: N-[4-[(E)-2-tert-butylsulfonyl-2-cyanoethenyl]phenyl]acetamide. InChIKey: AJFSBLSAYZPPRK-NTEUORMPSA-N.
| Molecular formula | C15H18N2O3S |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | N-[4-[(E)-2-tert-butylsulfonyl-2-cyanoethenyl]phenyl]acetamide |
| InChIKey | AJFSBLSAYZPPRK-NTEUORMPSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)/C=C(\C#N)/S(=O)(=O)C(C)(C)C |
Computed by PubChem (NCBI)