Products 349573-58-6
CAS 349573-58-6 appears in our catalog under these names: AR antagonist 3, AR antagonist 3, 99%, 99%, AR antagonist 3, 99.96%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 5mg, 10mM (in 1ml dmso), 10 mg, 50 mg, 10mM/1mL.
1-(dimethylsulfamoylamino)-4-phenylmethoxybenzene (CAS 349573-58-6) is a chemical compound with the molecular formula C15H18N2O3S and a molecular weight of 306.4 g/mol. IUPAC name: 1-(dimethylsulfamoylamino)-4-phenylmethoxybenzene. InChIKey: VOOWYFBNDLFQKS-UHFFFAOYSA-N.
| Molecular formula | C15H18N2O3S |
|---|---|
| Molecular weight | 306.4 g/mol |
| IUPAC name | 1-(dimethylsulfamoylamino)-4-phenylmethoxybenzene |
| InChIKey | VOOWYFBNDLFQKS-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)NC1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)