Products 1024754-31-1
CAS 1024754-31-1 is the registry number for 3-(tert-butyl)-4-(naphthylmethylene)-1-phenyl-2-pyrazolin-5-one. Offered by: Biosynth. Available pack sizes: 250mg.
(4Z)-5-tert-butyl-4-(naphthalen-1-ylmethylidene)-2-phenylpyrazol-3-one (CAS 1024754-31-1) is a chemical compound with the molecular formula C24H22N2O and a molecular weight of 354.4 g/mol. IUPAC name: (4Z)-5-tert-butyl-4-(naphthalen-1-ylmethylidene)-2-phenylpyrazol-3-one. InChIKey: ZXERCNQUZWABHC-PGMHBOJBSA-N.
| Molecular formula | C24H22N2O |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | (4Z)-5-tert-butyl-4-(naphthalen-1-ylmethylidene)-2-phenylpyrazol-3-one |
| InChIKey | ZXERCNQUZWABHC-PGMHBOJBSA-N |
| SMILES | CC(C)(C)C\1=NN(C(=O)/C1=C\C2=CC=CC3=CC=CC=C32)C4=CC=CC=C4 |
Computed by PubChem (NCBI)