Products 2416925-03-4
CAS 2416925-03-4 is the registry number for EGFR-IN-68. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(4-methoxyphenyl)-5-phenyl-3-[(E)-2-phenylethenyl]-3,4-dihydropyrazole (CAS 2416925-03-4) is a chemical compound with the molecular formula C24H22N2O and a molecular weight of 354.4 g/mol. IUPAC name: 2-(4-methoxyphenyl)-5-phenyl-3-[(E)-2-phenylethenyl]-3,4-dihydropyrazole. InChIKey: QGXAWMHVNOXVHQ-OUKQBFOZSA-N.
| Molecular formula | C24H22N2O |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 2-(4-methoxyphenyl)-5-phenyl-3-[(E)-2-phenylethenyl]-3,4-dihydropyrazole |
| InChIKey | QGXAWMHVNOXVHQ-OUKQBFOZSA-N |
| SMILES | COC1=CC=C(C=C1)N2C(CC(=N2)C3=CC=CC=C3)/C=C/C4=CC=CC=C4 |
Computed by PubChem (NCBI)