Products 1024861-10-6
CAS 1024861-10-6 is the registry number for 5-((3,4-dichlorophenyl)diazenyl)-2,2-dimethyl-1,3-dioxane-4,6-dione. Offered by: Biosynth. Available pack sizes: 250mg.
5-[(3,4-dichlorophenyl)diazenyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 1024861-10-6) is a chemical compound with the molecular formula C12H10Cl2N2O4 and a molecular weight of 317.12 g/mol. IUPAC name: 5-[(3,4-dichlorophenyl)diazenyl]-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: GVWGTZFUGNEEBK-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O4 |
|---|---|
| Molecular weight | 317.12 g/mol |
| IUPAC name | 5-[(3,4-dichlorophenyl)diazenyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | GVWGTZFUGNEEBK-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(C(=O)O1)N=NC2=CC(=C(C=C2)Cl)Cl)C |
Computed by PubChem (NCBI)