CAS 1192227-67-0 appears in our catalog under these names: 3-[1-(3,4-Dichlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid, 95%, 3-(1-(3,4-Dichlorophenyl)-2,5-dioxoimidazolidin-4-yl)propanoic acid, 95%, 3-(1-(3,4-Dichlorophenyl)-2,5-dioxoimidazolidin-4-yl)propanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-[1-(3,4-dichlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid (CAS 1192227-67-0) is a chemical compound with the molecular formula C12H10Cl2N2O4 and a molecular weight of 317.12 g/mol. IUPAC name: 3-[1-(3,4-dichlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid. InChIKey: UNBBFSPPPKOGFN-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O4 |
|---|---|
| Molecular weight | 317.12 g/mol |
| IUPAC name | 3-[1-(3,4-dichlorophenyl)-2,5-dioxoimidazolidin-4-yl]propanoic acid |
| InChIKey | UNBBFSPPPKOGFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N2C(=O)C(NC2=O)CCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)